Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
---|---|---|---|
General |
|||
HAM bands | ? | ? | |
Freq. stability | ? | ? | |
Tuning steps | ? | 9 / 10 kHz | |
Receiver |
|||
RX-range | VHF/UHF | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | |
Modulations | FM | AM N-FM W-FM SSB | |
Sensitivity | ? | ? | |
Selectivity | ? | ? | |
Filters | ? | ? | |
Receiver system | ? conversion superheterodyne | ? | |
IF-freqs. | ? | ? | |
Image rejection | ? | ? | |
Audio output | ? | 400 mW | |
Transmitter |
|||
TX-range | - | - | |
Modulations | - | - | |
RF-output | ? | ? | |
Connections |
|||
Antenna | Built-in telescopic | TNC + Built-in ferrite bar + Built-in sweep | |
Impedance | 50/75Ω | 50Ω | |
Other | - | - | |
Electrical |
|||
Power req. | Mains | 6V DC (4 × LR6 or external adapter) | |
Current RX | 15 W max | ? | |
TX | - | - | |
Physical |
|||
Manufactured | Between 198x and 198x in Taiwan | Between 19xx and 19xx | |
Dimensions | ? |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
|
Weight | ? | 650 gr (1.4 lbs) | |
Form factor | Base Station | Handheld | |
Other features |
|||
Memories | 10 channels in 1 bank(s) | 40 channels in 1 bank(s) | |
Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | |
Features | ? | ? | |
Accessories | ? | ? | |
MPN | REGENCY-R-001070 | SONY-ICF-PRO-000080-(HI-SCAN) |