Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 70cm | 2m | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 10m |
| Freq. stability | ? | ? | ? |
| Tuning steps | ? | ? | 3 / 5 / 9 (10) / 50 kHz depending on range |
Receiver |
|||
| RX-range | 430-440 MHz | 144-146 MHz |
Type 1 0.150-108 MHz Type 2 0.150-29.995 / 87.6-108 MHz Type 3 0.150-26.100 / 87.6-108 MHz |
| Modulations | FM | FM | AM N-FM W-FM SSB |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | ? | ? | LW/MW/SW/VHF: Dual conversion superheterodyne, FM: superheterodyne |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | 60 dB | ? |
| Audio output | ? | ? | 400 mW @ 10% THD + earphone jack |
Transmitter |
|||
| TX-range | 430-440 MHz | 144-146 MHz | - |
| Modulations | FM | FM | - |
| RF-output | ? | High: 50 W, Medium: 10 W, Low: 5 W | - |
Connections |
|||
| Antenna | - | - | TNC + Built-in ferrite bar + Built-in sweep |
| Impedance | 50 Ω | 50 Ω | 50Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | ?V DC | 13.8V DC | 6V DC (4 × LR6/AA or external adapter) |
| Current RX | ? | 0.6 A | ? |
| TX | ? | Max 11 A | - |
Physical |
|||
| Manufactured | Between 19xx and 19xx | Between 2003 and 200x in Japan | Between 1987 and 19xx in Japan |
| Dimensions | ? |
140 × 40 × 174 mm (5.51 × 1.57 × 6.85 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
| Weight | ? | 1,000 gr (2.2 lbs) | 650 gr (1.4 lbs) |
| Form factor | Handheld | Mobile | Handheld |
Other features |
|||
| Memories | ? | ? | 40 channels in 1 bank(s) |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | ? | CTCSS/DCS. 10F3 digital voice option (EJ-47U) | ? |
| Accessories | ? | ? |
AC power adapter AC-D4 Rechargeable battery pack BP-23 Car battery cord DCC-127A, DCC-120 or DCC-240 Battery case EBP-6 Connecting cord RK-69A VHF antenna AN-3 |
| MPN | ALINCO-DJ-000460E | ALINCO-DR-000120H | SONY-ICF-PRO-000070-(HI-SCAN) |