Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 10m | ? | |
| Freq. stability | ? | ? | |
| Tuning steps | 3 / 5 / 9 (10) / 50 kHz depending on range | HF: 1, MW: 9 / 10, FM: 50 kHz | |
Receiver |
|||
| RX-range |
Type 1 0.150-108 MHz Type 2 0.150-29.995 / 87.6-108 MHz Type 3 0.150-26.100 / 87.6-108 MHz |
3700-21950 kHz in 12 bands (with gaps) 76-108 MHz |
|
| Modulations | AM N-FM W-FM SSB | AM W-FM | |
| Sensitivity | ? | ? | |
| Selectivity | ? | ? | |
| Filters | ? | ? | |
| Receiver system | LW/MW/SW/VHF: Dual conversion superheterodyne, FM: superheterodyne | Double conversion superheterodyne | |
| IF-freqs. | ? | ? | |
| Image rejection | ? | ? | |
| Audio output | 400 mW @ 10% THD + earphone jack | ? | |
Transmitter |
|||
| TX-range | - | - | |
| Modulations | - | - | |
| RF-output | - | ? | |
Connections |
|||
| Antenna | TNC + Built-in ferrite bar + Built-in sweep | Built-in telescopic | |
| Impedance | 50Ω | -Ω | |
| Other | - | - | |
Electrical |
|||
| Power req. | 6V DC (4 × LR6/AA or external adapter) | 4.5V DC (3R6/AA) | |
| Current RX | ? | ? | |
| TX | - | - | |
Physical |
|||
| Manufactured | Between 1987 and 19xx in Japan | Between 1993 and 1996 in Japan | |
| Dimensions |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
169 × 112 × 35 mm (6.65 × 4.41 × 1.38 in) |
|
| Weight | 650 gr (1.4 lbs) | 450 gr (15.9 oz) | |
| Form factor | Handheld | Handheld | |
Other features |
|||
| Memories | 40 channels in 1 bank(s) | 15 channels in 1 bank(s) | |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | |
| Features | ? |
Sleep timer Local-DX switch |
|
| Accessories |
AC power adapter AC-D4 Rechargeable battery pack BP-23 Car battery cord DCC-127A, DCC-120 or DCC-240 Battery case EBP-6 Connecting cord RK-69A VHF antenna AN-3 |
? | |
| MPN | SONY-ICF-PRO-000070-(HI-SCAN) | SONY-ICF-SW000030 | |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee