Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 10m | ? | |
| Freq. stability | ? | ± 2.5 p.p.m. | |
| Tuning steps | 3 / 5 / 9 (10) / 50 kHz depending on range | ? | |
Receiver |
|||
| RX-range |
Type 1 0.150-108 MHz Type 2 0.150-29.995 / 87.6-108 MHz Type 3 0.150-26.100 / 87.6-108 MHz |
136-174 / 350-400 / 400-470 MHz | |
| Modulations | AM N-FM W-FM SSB | FM | |
| Sensitivity | ? | ? | |
| Selectivity | ? | ? | |
| Filters | ? | ? | |
| Receiver system | LW/MW/SW/VHF: Dual conversion superheterodyne, FM: superheterodyne | ? | |
| IF-freqs. | ? | ? | |
| Image rejection | ? | ? | |
| Audio output | 400 mW @ 10% THD + earphone jack | ? | |
Transmitter |
|||
| TX-range | - | 136-174 / 350-400 / 400-470 MHz | |
| Modulations | - | FM | |
| RF-output | - | 10 / 5 / 1 W | |
Connections |
|||
| Antenna | TNC + Built-in ferrite bar + Built-in sweep | SO-239 | |
| Impedance | 50Ω | 50Ω | |
| Other | - | - | |
Electrical |
|||
| Power req. | 6V DC (4 × LR6/AA or external adapter) | 7.4 V DC, Li-ion Battery 1300mA | |
| Current RX | ? | ? | |
| TX | - | ? | |
Physical |
|||
| Manufactured | Between 1987 and 19xx in Japan | Between 201x and 20xx in China | |
| Dimensions |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
64 × 120 × 34 mm (2.52 × 4.72 × 1.34 in) |
|
| Weight | 650 gr (1.4 lbs) | 288 gr (10.2 oz) with belt clip and antenna | |
| Form factor | Handheld | Handheld | |
Other features |
|||
| Memories | 40 channels in 1 bank(s) | 200 channels in 1 bank(s) | |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | |
| Features | ? |
CTCSS / DSC DTMF |
|
| Accessories |
AC power adapter AC-D4 Rechargeable battery pack BP-23 Car battery cord DCC-127A, DCC-120 or DCC-240 Battery case EBP-6 Connecting cord RK-69A VHF antenna AN-3 |
? | |
| MPN | SONY-ICF-PRO-000070-(HI-SCAN) | TOPSUNG-TS-000686 | |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee