Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | ? | ? | ? |
| Freq. stability | ? | ? | ? |
| Tuning steps | ? | 9 / 10 kHz | ? |
Receiver |
|||
| RX-range | 0.55-1.6 / 1.6-4.8 / 4.8-14.5 / 10.5-30 MHz | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | ? |
| Modulations | AM CW | AM N-FM W-FM SSB | - |
| Sensitivity | 1.5 µV | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | 7 tubes | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | ? | 400 mW | ? |
Transmitter |
|||
| TX-range | - | - | 3.5-30 MHz |
| Modulations | - | - | AM CW SSB |
| RF-output | ? | ? | 1000 W input (AM/CW/SSB) |
Connections |
|||
| Antenna | - | TNC + Built-in ferrite bar + Built-in sweep | - |
| Impedance | ? | 50Ω | 50/500Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | Mains | 6V DC (4 × LR6 or external adapter) | Mains |
| Current RX | ? | ? | ? |
| TX | - | - | ? |
Physical |
|||
| Manufactured | Between 1963 and 1966 | Between 19xx and 19xx | Between 1958 and 196x in USA |
| Dimensions |
330 × 200 × 255 mm (12.99 × 7.87 × 10.04 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
500 × 750 × 840 mm (19.69 × 29.53 × 33.07 in) |
| Weight | 8.60 kg (19.0 lbs) | 650 gr (1.4 lbs) | 180.00 kg (397.1 lbs) |
| Form factor | Base Station | Handheld | Base Station |
Other features |
|||
| Memories | ? | 40 channels in 1 bank(s) | ? |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features |
Electrical bandspread on 80, 40, 20 ,15 and 10m bands Slide rule display AVC-MVC selector ANL BFO Antenna trimmer |
? | ? |
| Accessories | ? | ? | ? |
| MPN | LAFAYETTE-HA-000063 | SONY-ICF-PRO-000080-(HI-SCAN) | E.F.-JOHNSON-DESK-KILOWATT |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee