Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | ? | ? | ? |
| Freq. stability | ? | ? | ? |
| Tuning steps | ? | 9 / 10 kHz | ? |
Receiver |
|||
| RX-range |
0.153-30 / 87.6-108 MHz (Type 1) 0.153-30 / 76-108 MHz (Type 2) |
0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | 0.15-30 / 87.5-108 MHz |
| Modulations | AM W-FM CW SSB | AM N-FM W-FM SSB | AM W-FM |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | ? | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | ? | 400 mW | ? |
Transmitter |
|||
| TX-range | - | - | - |
| Modulations | - | - | - |
| RF-output | ? | ? | ? |
Connections |
|||
| Antenna | Built-in ferrite bar + Built-in sweep | TNC + Built-in ferrite bar + Built-in sweep | Built-in ferrite bar + Built-in sweep |
| Impedance | ? | 50Ω | ? |
| Other | - | - | - |
Electrical |
|||
| Power req. | 6V DC (4R6) or 6V DC external | 6V DC (4 × LR6 or external adapter) | 3V DC (2LR6) |
| Current RX | ? | ? | ? |
| TX | - | - | - |
Physical |
|||
| Manufactured | Between 1983 and 1987 in Japan | Between 19xx and 19xx | Between 1988 and 1993 in Japan |
| Dimensions |
185 × 119 × 32 mm (7.28 × 4.69 × 1.26 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
120.65 × 71.12 × 25.4 mm (4.75 × 2.80 × 1.00 in) |
| Weight | 640 gr (1.4 lbs) including batteries | 650 gr (1.4 lbs) | 227 gr (8.0 oz) |
| Form factor | Handheld | Handheld | Handheld |
Other features |
|||
| Memories | 10 channels in 1 bank(s) | 40 channels in 1 bank(s) | ? |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | ? | ? | ? |
| Accessories | ? | ? | ? |
| MPN | SONY-ICF-007600D | SONY-ICF-PRO-000080-(HI-SCAN) | SONY-ICF-SW000001 |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee