Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
---|---|---|---|
General |
|||
HAM bands | ? | 11m (CB) | |
Freq. stability | ? | 0.001% | |
Tuning steps | 9 / 10 kHz | Channelized | |
Receiver |
|||
RX-range | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | 26.695-27.845 MHz | |
Modulations | AM N-FM W-FM SSB | AM SSB | |
Sensitivity | ? | < 0.5 µV / < 0.15 µV for 10 dB S/N (AM/ SSB) | |
Selectivity | ? | ? | |
Filters | ? | ? | |
Receiver system | ? | ? | |
IF-freqs. | ? |
1st: 10.695 MHz 2nd: 455 kHz |
|
Image rejection | ? | -50 dB | |
Audio output | 400 mW | 2.5W @ 10% THD | |
Transmitter |
|||
TX-range | - | 26.695-27.845 MHz | |
Modulations | - | AM SSB | |
RF-output | ? | AM: 4 W / SSB: 12 W PEP | |
Connections |
|||
Antenna | TNC + Built-in ferrite bar + Built-in sweep | SO-239 | |
Impedance | 50Ω | 50Ω | |
Other | - | - | |
Electrical |
|||
Power req. | 6V DC (4 × LR6 or external adapter) | Mains / 13.8 V DC | |
Current RX | ? | 1 A max | |
TX | - | 3.5 A max | |
Physical |
|||
Manufactured | Between 19xx and 19xx | Between 19xx and 19xx | |
Dimensions |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
285 × 135 × 342 mm (11.22 × 5.31 × 13.46 in) |
|
Weight | 650 gr (1.4 lbs) | 5.40 kg (11.9 lbs) | |
Form factor | Handheld | Base Station | |
Other features |
|||
Memories | 40 channels in 1 bank(s) | 40 channels in 1 bank(s) | |
Usage | Amateur / Ham radio operators | Citizen Band (27Mc) | |
Features | ? | ? | |
Accessories | ? | ? | |
MPN | SONY-ICF-PRO-000080-(HI-SCAN) | GALAXY-DX-002547 |