Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 80m 40m 20m 15m 10m | 40m | ? |
| Freq. stability | ? | ? | ? |
| Tuning steps | Continuous | Continuous | 9 / 10 kHz |
Receiver |
|||
| RX-range | 80-10 m | 40 m | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) |
| Modulations | AM CW USB LSB | CW | AM N-FM W-FM SSB |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | ? | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | ? | ? | 400 mW |
Transmitter |
|||
| TX-range | - | 40 m | - |
| Modulations | - | CW | - |
| RF-output | ? | 1 W | ? |
Connections |
|||
| Antenna | - | SO-239 | TNC + Built-in ferrite bar + Built-in sweep |
| Impedance | 50/75Ω | 50Ω | 50Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | Mains | 9.6V DC | 6V DC (4 × LR6 or external adapter) |
| Current RX | ? | ? | ? |
| TX | - | ? | - |
Physical |
|||
| Manufactured | Between 1960 and 1961 | Between 19xx and 200x in Japan | Between 19xx and 19xx |
| Dimensions |
304 × 177 × 228 mm (11.97 × 6.97 × 8.98 in) |
? |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
| Weight | 6.60 kg (14.6 lbs) | ? | 650 gr (1.4 lbs) |
| Form factor | Base Station | Mobile | Handheld |
Other features |
|||
| Memories | None | None | 40 channels in 1 bank(s) |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | Seven optional bands | ? | ? |
| Accessories | ? | ? | ? |
| MPN | DRAKE-000002-A | MIZUHO-P-000007DX | SONY-ICF-PRO-000080-(HI-SCAN) |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee