Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 10m | ? | |
| Freq. stability | ? | ? | |
| Tuning steps | 0.1 kHz | 9 / 10 kHz | |
Receiver |
|||
| RX-range | 0.01-30 MHz + FM broadcast band | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | |
| Modulations | AM CW USB LSB | AM N-FM W-FM SSB | |
| Sensitivity |
AM < 1 µV SSB < 0,3 µV |
? | |
| Selectivity |
AM 10 kHz (-6 dB), 16 kHz (-60 dB) 4,4 (-6 dB), 8 kHz (-60 dB) SSB 2,0 (-6 dB), 3,4 kHz (-60 dB) |
? | |
| Filters | ? | ? | |
| Receiver system | Double conversion superheterodyne | ? | |
| IF-freqs. |
1st: 55.845 MHz 2nd: 455 kHz |
? | |
| Image rejection | ? | ? | |
| Audio output | ? | 400 mW | |
Transmitter |
|||
| TX-range | - | - | |
| Modulations | - | - | |
| RF-output | ? | ? | |
Connections |
|||
| Antenna | Built-in sweep | TNC + Built-in ferrite bar + Built-in sweep | |
| Impedance | ? | 50Ω | |
| Other | - | - | |
Electrical |
|||
| Power req. | 12 V DC external, 8 x R20 + 2 x R6 batteries or mains | 6V DC (4 × LR6 or external adapter) | |
| Current RX | ? | ? | |
| TX | - | - | |
Physical |
|||
| Manufactured | Between 1981 and 1986 in Japan | Between 19xx and 19xx | |
| Dimensions |
254 × 102 × 335 mm (10.00 × 4.02 × 13.19 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
|
| Weight | 7.71 kg (17.0 lbs) | 650 gr (1.4 lbs) | |
| Form factor | Base Station | Handheld | |
Other features |
|||
| Memories | None | 40 channels in 1 bank(s) | |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | |
| Features |
S/Battery-Meter Record Jack Pre-selector NB Dial Lamp Dial Lamp Switch Carry Handle Muting RF Gain |
? | |
| Accessories | ? | ? | |
| MPN | SONY-CRF-000001 | SONY-ICF-PRO-000080-(HI-SCAN) | |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee