Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 2m | ? | ? |
| Freq. stability | ? | ? | ? |
| Tuning steps | ? | ? | 9 / 10 kHz |
Receiver |
|||
| RX-range | 144-148 MHz | 0.3-30 MHz | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) |
| Modulations | FM | AM SSB | AM N-FM W-FM SSB |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | ? | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | ? | ? | 400 mW |
Transmitter |
|||
| TX-range | 144-148 MHz | - | - |
| Modulations | FM | - | - |
| RF-output | 3 W | ? | ? |
Connections |
|||
| Antenna | BNC | - | TNC + Built-in ferrite bar + Built-in sweep |
| Impedance | 50Ω | 50 Ω | 50Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | ?V DC | Mains | 6V DC (4 × LR6 or external adapter) |
| Current RX | ? | ? | ? |
| TX | ? | - | - |
Physical |
|||
| Manufactured | Between 19xx and 19xx | Between 1965 and 1969 in Great Britain | Between 19xx and 19xx |
| Dimensions | ? | ? |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
| Weight | ? | ? | 650 gr (1.4 lbs) |
| Form factor | Handheld | Base Station | Handheld |
Other features |
|||
| Memories | ? | ? | 40 channels in 1 bank(s) |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | ? | ? | ? |
| Accessories | ? | ? | ? |
| MPN | ALINCO-ALX-000002T | EDDYSTONE-000830/2 | SONY-ICF-PRO-000080-(HI-SCAN) |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee