Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 6m 10m | ? | ? |
| Freq. stability | ? | ? | ? |
| Tuning steps | Continuous | ? | 9 / 10 kHz |
Receiver |
|||
| RX-range | 0.54-62 MHz in 6 bands | 1.25-40 MHz | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) |
| Modulations | AM CW | AM CW | AM N-FM W-FM SSB |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | 11 tubes | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | ? | ? | 400 mW |
Transmitter |
|||
| TX-range | - | - | - |
| Modulations | - | - | - |
| RF-output | ? | ? | ? |
Connections |
|||
| Antenna | - | Clamps / screws | TNC + Built-in ferrite bar + Built-in sweep |
| Impedance | ? | 100 Ω | 50Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | Mains | Separate PSU | 6V DC (4 × LR6 or external adapter) |
| Current RX | ? | ? | ? |
| TX | - | - | - |
Physical |
|||
| Manufactured | Between 1937 and 1938 in USA | Between 1939 and 1945 in USA | Between 19xx and 19xx |
| Dimensions | ? | ? |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
| Weight | ? | 33.00 kg (72.8 lbs) | 650 gr (1.4 lbs) |
| Form factor | Unknown | Base Station | Handheld |
Other features |
|||
| Memories | None | ? | 40 channels in 1 bank(s) |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | ? | ? | ? |
| Accessories | ? | ? | ? |
| MPN | HALLICRAFTERS-S-000016-SUPER-SKYRIDER | HAMMARLUND-SP-000220-SX | SONY-ICF-PRO-000080-(HI-SCAN) |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee