Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 2m | ? | 160m 80m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 10m |
| Freq. stability | ? | ? | ? |
| Tuning steps | 5 kHz | 9 / 10 kHz | ? |
Receiver |
|||
| RX-range | 144-148 MHz | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | 0.15-30 MHz |
| Modulations | FM | AM N-FM W-FM SSB | AM CW USB LSB |
| Sensitivity | ? | ? | ? |
| Selectivity | ? | ? | ? |
| Filters | ? | ? | ? |
| Receiver system | ? | ? | ? |
| IF-freqs. | ? | ? | ? |
| Image rejection | ? | ? | ? |
| Audio output | Internal speaker | 400 mW | ? |
Transmitter |
|||
| TX-range | 144-148 MHz | - | 10-160 m + WARC |
| Modulations | FM | - | AM CW USB LSB |
| RF-output | High: 2.5-6 W (depending on voltage), Low: 1 W | ? | Max 125 W |
Connections |
|||
| Antenna | BNC | TNC + Built-in ferrite bar + Built-in sweep | SO-239 |
| Impedance | 50Ω | 50Ω | 50 Ω |
| Other | - | - | - |
Electrical |
|||
| Power req. | 7.2-13.8V DC | 6V DC (4 × LR6 or external adapter) | Mains |
| Current RX | 25-100 mA | ? | ? |
| TX | Max 1.1 A | - | ? |
Physical |
|||
| Manufactured | Between 199x and 199x | Between 19xx and 19xx | Between 1982 and 198x |
| Dimensions |
65 × 117 × 37 mm (2.56 × 4.61 × 1.46 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
? |
| Weight | 540 gr (1.2 lbs) | 650 gr (1.4 lbs) | ? |
| Form factor | Handheld | Handheld | Base Station |
Other features |
|||
| Memories | ? | 40 channels in 1 bank(s) | ? |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | Amateur / Ham radio operators |
| Features | CTCSS and DTMF | ? | Auto-AT option |
| Accessories | ? | ? | ? |
| MPN | RADIOSHACK-REALISTIC-HTX-000202 | SONY-ICF-PRO-000080-(HI-SCAN) | KENWOOD-TS-000930 |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee