Compare rigs
Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | ? | ? | |
| Freq. stability | ± 0.2 PPM | ? | |
| Tuning steps | 1 / 10 / 100 Hz, 1 / 5 / 9 / 10 / 100 kHz | 9 / 10 kHz | |
Receiver |
|||
| RX-range | 0.09-30 MHz | 0.15-108 MHz (115.15-223 MHz with optional FRQ-80 converter) | |
| Modulations | AM CW USB LSB DSB ISB FSK FAX | AM N-FM W-FM SSB | |
| Sensitivity | 2µV SSB 1.6-30 MHz (10 dB S+N/N) | ? | |
| Selectivity | 6.0 / 3.0 / 2.7 / 1.0 / 0.5 / 0.3 kHz | ? | |
| Filters | ? | ? | |
| Receiver system | Triple Conversion Superheterodyne | ? | |
| IF-freqs. |
1st 70.455 MHz 2nd 455 kHz 3rd 17 kHz |
? | |
| Image rejection | > 70 dB | ? | |
| Audio output | 1W | 400 mW | |
Transmitter |
|||
| TX-range | - | - | |
| Modulations | - | - | |
| RF-output | ? | ? | |
Connections |
|||
| Antenna | - | TNC + Built-in ferrite bar + Built-in sweep | |
| Impedance | 50 Ω | 50Ω | |
| Other | - | - | |
Electrical |
|||
| Power req. | 24V DC or mains | 6V DC (4 × LR6 or external adapter) | |
| Current RX | ? | ? | |
| TX | - | - | |
Physical |
|||
| Manufactured | Between 2007 and 200x | Between 19xx and 19xx | |
| Dimensions |
480 × 149 × 294 mm (18.90 × 5.87 × 11.57 in) |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
|
| Weight | 10.00 kg (22.1 lbs) | 650 gr (1.4 lbs) | |
| Form factor | Base Station | Handheld | |
Other features |
|||
| Memories | 300 channels in 1 bank(s) | 40 channels in 1 bank(s) | |
| Usage | Amateur / Ham radio operators | Amateur / Ham radio operators | |
| Features | ? | ? | |
| Accessories | ? | ? | |
| MPN | JRC-NRD-000630 | SONY-ICF-PRO-000080-(HI-SCAN) | |
About
RigReference.com aims to become the most comprehensive reference guide for ham radio equipment. If you have any questions or suggestions, or if you'd like to participate, please get in touch.
Buy me a coffee