Compare specifications between amateur radios. Simply select up to 3 radios and compare them side-by-side, including images and descriptions.
|
|
|
|
|
|---|---|---|---|
General |
|||
| HAM bands | 160m 80m 60m 40m 30m (WARC) 20m 17m (WARC) 15m 12m (WARC) 11m (CB) 10m | ? | |
| Freq. stability | ? | ? | |
| Tuning steps | 3 / 5 / 9 (10) / 50 kHz depending on range | ? | |
Receiver |
|||
| RX-range |
Type 1 0.150-108 MHz Type 2 0.150-29.995 / 87.6-108 MHz Type 3 0.150-26.100 / 87.6-108 MHz |
2-12 MHz | |
| Modulations | AM N-FM W-FM SSB | AM CW | |
| Sensitivity | ? | ? | |
| Selectivity | ? | ? | |
| Filters | ? | ? | |
| Receiver system | LW/MW/SW/VHF: Dual conversion superheterodyne, FM: superheterodyne | Single conversion | |
| IF-freqs. | ? | 465 kHz | |
| Image rejection | ? | ? | |
| Audio output | 400 mW @ 10% THD + earphone jack | ? | |
Transmitter |
|||
| TX-range | - | 2-12 MHz | |
| Modulations | - | AM CW | |
| RF-output | - | 10/12.5 W | |
Connections |
|||
| Antenna | TNC + Built-in ferrite bar + Built-in sweep | BNC + Proprietary (military) | |
| Impedance | 50Ω | 50Ω | |
| Other | - | - | |
Electrical |
|||
| Power req. | 6V DC (4 × LR6/AA or external adapter) | 24V DC | |
| Current RX | ? | ? | |
| TX | - | ? | |
Physical |
|||
| Manufactured | Between 1987 and 19xx in Japan | Between 1958 and 1970 in Netherlands | |
| Dimensions |
90 × 182 × 50 mm (3.54 × 7.17 × 1.97 in) |
245 × 475 × 295 mm (9.65 × 18.70 × 11.61 in) |
|
| Weight | 650 gr (1.4 lbs) | 21.50 kg (47.4 lbs) | |
| Form factor | Handheld | Mobile | |
Other features |
|||
| Memories | 40 channels in 1 bank(s) | ? | |
| Usage | Amateur / Ham radio operators | Military communication | |
| Features | ? | ? | |
| Accessories |
AC power adapter AC-D4 Rechargeable battery pack BP-23 Car battery cord DCC-127A, DCC-120 or DCC-240 Battery case EBP-6 Connecting cord RK-69A VHF antenna AN-3 |
? | |
| MPN | SONY-ICF-PRO-000070-(HI-SCAN) | VAN-DER-HEEM-GRC-003030 | |